CAS 1147348-13-7 is the registry number for 2-(Difluoromethoxy)-N-(4H-1,2,4-triazol-3-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethoxy)-N-(1H-1,2,4-triazol-5-yl)benzamide (CAS 1147348-13-7) is a chemical compound with the molecular formula C10H8F2N4O2 and a molecular weight of 254.19 g/mol. IUPAC name: 2-(difluoromethoxy)-N-(1H-1,2,4-triazol-5-yl)benzamide. InChIKey: QQDBIPFPAYNCIY-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N4O2 |
|---|---|
| Molecular weight | 254.19 g/mol |
| IUPAC name | 2-(difluoromethoxy)-N-(1H-1,2,4-triazol-5-yl)benzamide |
| InChIKey | QQDBIPFPAYNCIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NC=NN2)OC(F)F |
Computed by PubChem (NCBI)