Products 114737-75-6

CAS 114737-75-6 is the registry number for Etodolac Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol (CAS 114737-75-6) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol. InChIKey: WQHGTUYNOTUVDR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO
Molecular weight191.27 g/mol
IUPAC name2-(7-ethyl-2,3-dihydro-1H-indol-3-yl)ethanol
InChIKeyWQHGTUYNOTUVDR-UHFFFAOYSA-N
SMILESCCC1=C2C(=CC=C1)C(CN2)CCO

Computed by PubChem (NCBI)