CAS 114744-83-1 appears in our catalog under these names: Benzyl (S)-(1-(methoxy(methyl)amino)-1-oxopropan-2-yl)carbamate, 95%, N-[(1S)-2-(Methoxymethylamino)-1-methyl-2-oxoethyl]-carbamic acid phenylmethyl ester, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg, 10g.
Benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate (CAS 114744-83-1) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate. InChIKey: JJWLCBIYQXRMNO-JTQLQIEISA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | JJWLCBIYQXRMNO-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)N(C)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)