CAS 1147647-29-7 is the registry number for 3-Bromo-n-(cyclopropylmethyl)-4-iodobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N-(cyclopropylmethyl)-4-iodobenzamide (CAS 1147647-29-7) is a chemical compound with the molecular formula C11H11BrINO and a molecular weight of 380.02 g/mol. IUPAC name: 3-bromo-N-(cyclopropylmethyl)-4-iodobenzamide. InChIKey: MBBOJJQKSSZTBC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrINO |
|---|---|
| Molecular weight | 380.02 g/mol |
| IUPAC name | 3-bromo-N-(cyclopropylmethyl)-4-iodobenzamide |
| InChIKey | MBBOJJQKSSZTBC-UHFFFAOYSA-N |
| SMILES | C1CC1CNC(=O)C2=CC(=C(C=C2)I)Br |
Computed by PubChem (NCBI)