Products 1147720-20-4
CAS 1147720-20-4 is the registry number for N-(1-(2,5-Dimethylthiophen-3-yl)ethyl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]thiophene-2-carboxamide (CAS 1147720-20-4) is a chemical compound with the molecular formula C13H15NOS2 and a molecular weight of 265.4 g/mol. IUPAC name: N-[1-(2,5-dimethylthiophen-3-yl)ethyl]thiophene-2-carboxamide. InChIKey: HIXUQKJPGJTJHN-UHFFFAOYSA-N.
| Molecular formula | C13H15NOS2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]thiophene-2-carboxamide |
| InChIKey | HIXUQKJPGJTJHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C(C)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)