Products 1147861-80-0
CAS 1147861-80-0 appears in our catalog under these names: D–Gluconic acid， 6–((2E)–3–(3，4–dihydroxyphenyl)–2–propenoate), trans-Caffeoyl-6-O-D-gluconic acid, ≥85%, ≥85%, trans-Caffeoyl-6-O-D-gluconic acid. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
(2R,3S,4R,5R)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3,4,5-tetrahydroxyhexanoic acid (CAS 1147861-80-0) is a chemical compound with the molecular formula C15H18O10 and a molecular weight of 358.30 g/mol. IUPAC name: (2R,3S,4R,5R)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3,4,5-tetrahydroxyhexanoic acid. InChIKey: IZTWJFXKOMYWBU-XAVAJTHBSA-N.
| Molecular formula | C15H18O10 |
|---|---|
| Molecular weight | 358.30 g/mol |
| IUPAC name | (2R,3S,4R,5R)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3,4,5-tetrahydroxyhexanoic acid |
| InChIKey | IZTWJFXKOMYWBU-XAVAJTHBSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)OC[C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O)O |
Computed by PubChem (NCBI)