CAS 1148050-25-2 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,1,1-trifluoropropan-2-ol, 3-(4-Chlorophenyl)-1,1,1-trifluoropropan-2-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol (CAS 1148050-25-2) is a chemical compound with the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: IYYUIIVBJNRBSG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | IYYUIIVBJNRBSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)