CAS 1149343-61-2 is the registry number for 2–(3–Bromophenyl)–4–phenylquinazoline. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 5g.
2-(3-bromophenyl)-4-phenylquinazoline (CAS 1149343-61-2) is a chemical compound with the molecular formula C20H13BrN2 and a molecular weight of 361.2 g/mol. IUPAC name: 2-(3-bromophenyl)-4-phenylquinazoline. InChIKey: OXTGJLAJVNZAKW-UHFFFAOYSA-N.
| Molecular formula | C20H13BrN2 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4-phenylquinazoline |
| InChIKey | OXTGJLAJVNZAKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=CC=CC=C32)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)