CAS 115-27-5 appears in our catalog under these names: 1,4,5,6,7,7-HEXACHLORO-5-NORBORNENE-2,3&, 1,4,5,6,7,7-Hexachloro-5-norbornene-2,3-dicarboxylic anhydride, Chlorendic anhydride, 95%, Chlorendic Anhydride, Het Anhydride. Offered by: Sigma-Aldrich, Chemat, Combi-blocks, TRC, GLPBio. Available pack sizes: 1KG, 25g, 50g, 100g, 250g, 5kg, 5g, 500g.
1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 115-27-5) is a chemical compound with the molecular formula C9H2Cl6O3 and a molecular weight of 370.8 g/mol. IUPAC name: 1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: FLBJFXNAEMSXGL-UHFFFAOYSA-N.
| Molecular formula | C9H2Cl6O3 |
|---|---|
| Molecular weight | 370.8 g/mol |
| IUPAC name | 1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | FLBJFXNAEMSXGL-UHFFFAOYSA-N |
| SMILES | C12C(C(=O)OC1=O)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)