CAS 115-41-3 appears in our catalog under these names: 3,3-Bis(3,4-dihydroxyphenyl)-3H-benzo(c)(1,2)oxathiole 1,1-dioxide, 98+%, CatecholVioletIndicator(4·0–7·0), Catechol Violet , Pyrocatechol Violet, 80.00%, Catechol violet. Offered by: AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 500g, 25g, 5g, 50g, 1g, 100g, 250g, 250 mg.
4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]benzene-1,2-diol (CAS 115-41-3) is a chemical compound with the molecular formula C19H14O7S and a molecular weight of 386.4 g/mol. IUPAC name: 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]benzene-1,2-diol. InChIKey: RRRCKIRSVQAAAS-UHFFFAOYSA-N.
| Molecular formula | C19H14O7S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]benzene-1,2-diol |
| InChIKey | RRRCKIRSVQAAAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O |
Computed by PubChem (NCBI)