CAS 115-51-5 appears in our catalog under these names: Ambutonium bromide (BL700), Ambutonium Bromide, 98%, Ambutonium Bromide, >95% (HPLC), Ambutonium Bromide. Offered by: GLPBio, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 5mg, on request, 100mg, 10mg, 1mg, 20mg, 100 mg, 10 mg.
(4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium bromide (CAS 115-51-5) is a chemical compound with the molecular formula C20H27BrN2O and a molecular weight of 391.3 g/mol. IUPAC name: (4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium bromide. InChIKey: VTAGVKVPFBOVRM-UHFFFAOYSA-N.
| Molecular formula | C20H27BrN2O |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | (4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium bromide |
| InChIKey | VTAGVKVPFBOVRM-UHFFFAOYSA-N |
| SMILES | CC[N+](C)(C)CCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N.[Br-] |
Computed by PubChem (NCBI)