CAS 115-93-5 appears in our catalog under these names: Cythioate, 95%, Cythioate, Proban, Cythioate, ROTICHROM® Pestilyse® HPLC, 10 mg, glass. Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 10mg, 1g, 50mg, 25mg, 500mg, Get quote.
4-dimethoxyphosphinothioyloxybenzenesulfonamide (CAS 115-93-5) is a chemical compound with the molecular formula C8H12NO5PS2 and a molecular weight of 297.3 g/mol. IUPAC name: 4-dimethoxyphosphinothioyloxybenzenesulfonamide. InChIKey: BSBSDQUZDZXGFN-UHFFFAOYSA-N.
| Molecular formula | C8H12NO5PS2 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 4-dimethoxyphosphinothioyloxybenzenesulfonamide |
| InChIKey | BSBSDQUZDZXGFN-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)OC1=CC=C(C=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)