CAS 1150114-25-2 is the registry number for 2,5-Difluoro-4-thiocyanatoaniline hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(4-amino-2,5-difluorophenyl) thiocyanate;hydrochloride (CAS 1150114-25-2) is a chemical compound with the molecular formula C7H5ClF2N2S and a molecular weight of 222.64 g/mol. IUPAC name: (4-amino-2,5-difluorophenyl) thiocyanate;hydrochloride. InChIKey: JHSXQAMCTCNIDG-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2N2S |
|---|---|
| Molecular weight | 222.64 g/mol |
| IUPAC name | (4-amino-2,5-difluorophenyl) thiocyanate;hydrochloride |
| InChIKey | JHSXQAMCTCNIDG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)SC#N)F)N.Cl |
Computed by PubChem (NCBI)