Products 1150114-25-2

CAS 1150114-25-2 is the registry number for 2,5-Difluoro-4-thiocyanatoaniline hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

(4-amino-2,5-difluorophenyl) thiocyanate;hydrochloride (CAS 1150114-25-2) is a chemical compound with the molecular formula C7H5ClF2N2S and a molecular weight of 222.64 g/mol. IUPAC name: (4-amino-2,5-difluorophenyl) thiocyanate;hydrochloride. InChIKey: JHSXQAMCTCNIDG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2N2S
Molecular weight222.64 g/mol
IUPAC name(4-amino-2,5-difluorophenyl) thiocyanate;hydrochloride
InChIKeyJHSXQAMCTCNIDG-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)SC#N)F)N.Cl

Computed by PubChem (NCBI)