Products 1150114-31-0

CAS 1150114-31-0 is the registry number for 3-(4-Ethoxycarbonylbutyloxy)-2,4,6-trifluorophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

[3-(5-ethoxy-5-oxopentoxy)-2,4,6-trifluorophenyl]boronic acid (CAS 1150114-31-0) is a chemical compound with the molecular formula C13H16BF3O5 and a molecular weight of 320.07 g/mol. IUPAC name: [3-(5-ethoxy-5-oxopentoxy)-2,4,6-trifluorophenyl]boronic acid. InChIKey: IZPKPMGAODMUFI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16BF3O5
Molecular weight320.07 g/mol
IUPAC name[3-(5-ethoxy-5-oxopentoxy)-2,4,6-trifluorophenyl]boronic acid
InChIKeyIZPKPMGAODMUFI-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1F)F)OCCCCC(=O)OCC)F)(O)O

Computed by PubChem (NCBI)