CAS 1150114-46-7 appears in our catalog under these names: 4-(tert-Butyldimethylsilyloxy)-3,5-dichlorophenylboronic acid, 98%, (4-((tert-Butyldimethylsilyl)oxy)-3,5-dichlorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dichlorophenyl]boronic acid (CAS 1150114-46-7) is a chemical compound with the molecular formula C12H19BCl2O3Si and a molecular weight of 321.1 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-3,5-dichlorophenyl]boronic acid. InChIKey: WNDFXSADTRWDGK-UHFFFAOYSA-N.
| Molecular formula | C12H19BCl2O3Si |
|---|---|
| Molecular weight | 321.1 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-3,5-dichlorophenyl]boronic acid |
| InChIKey | WNDFXSADTRWDGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)O[Si](C)(C)C(C)(C)C)Cl)(O)O |
Computed by PubChem (NCBI)