CAS 1150114-64-9 is the registry number for 2-Amino-4-(isopropoxycarbonyl)phenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
(2-amino-4-propan-2-yloxycarbonylphenyl)boronic acid;hydrochloride (CAS 1150114-64-9) is a chemical compound with the molecular formula C10H15BClNO4 and a molecular weight of 259.50 g/mol. IUPAC name: (2-amino-4-propan-2-yloxycarbonylphenyl)boronic acid;hydrochloride. InChIKey: VMZVJIYHNDCEDU-UHFFFAOYSA-N.
| Molecular formula | C10H15BClNO4 |
|---|---|
| Molecular weight | 259.50 g/mol |
| IUPAC name | (2-amino-4-propan-2-yloxycarbonylphenyl)boronic acid;hydrochloride |
| InChIKey | VMZVJIYHNDCEDU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC(C)C)N)(O)O.Cl |
Computed by PubChem (NCBI)