Products 1150114-64-9

CAS 1150114-64-9 is the registry number for 2-Amino-4-(isopropoxycarbonyl)phenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

(2-amino-4-propan-2-yloxycarbonylphenyl)boronic acid;hydrochloride (CAS 1150114-64-9) is a chemical compound with the molecular formula C10H15BClNO4 and a molecular weight of 259.50 g/mol. IUPAC name: (2-amino-4-propan-2-yloxycarbonylphenyl)boronic acid;hydrochloride. InChIKey: VMZVJIYHNDCEDU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BClNO4
Molecular weight259.50 g/mol
IUPAC name(2-amino-4-propan-2-yloxycarbonylphenyl)boronic acid;hydrochloride
InChIKeyVMZVJIYHNDCEDU-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)C(=O)OC(C)C)N)(O)O.Cl

Computed by PubChem (NCBI)