CAS 1150271-37-6 is the registry number for 2-Fluoro-5-pentanoylphenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-1-one (CAS 1150271-37-6) is a chemical compound with the molecular formula C17H24BFO3 and a molecular weight of 306.2 g/mol. IUPAC name: 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-1-one. InChIKey: WWSWIZAGPCBCIK-UHFFFAOYSA-N.
| Molecular formula | C17H24BFO3 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-1-one |
| InChIKey | WWSWIZAGPCBCIK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)CCCC)F |
Computed by PubChem (NCBI)