CAS 1150271-58-1 is the registry number for 6-Methoxycarbonyl-2,2-difluorobenzo[d][1,3]dioxole-4-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate (CAS 1150271-58-1) is a chemical compound with the molecular formula C14H15BF2O6 and a molecular weight of 328.07 g/mol. IUPAC name: methyl 7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate. InChIKey: HAEILCLKAYVDDG-UHFFFAOYSA-N.
| Molecular formula | C14H15BF2O6 |
|---|---|
| Molecular weight | 328.07 g/mol |
| IUPAC name | methyl 7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2,2-difluoro-1,3-benzodioxole-5-carboxylate |
| InChIKey | HAEILCLKAYVDDG-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC3=C2OC(O3)(F)F)C(=O)OC |
Computed by PubChem (NCBI)