Products 115035-47-7
CAS 115035-47-7 appears in our catalog under these names: {2-[(2S)-2-{[(tert-butoxy)carbonyl]amino}propanamido]acetamido}acetic acid, 95%, Boc–Ala–Gly–Gly–OH, Boc-Ala-Gly-Gly-OH. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetic acid (CAS 115035-47-7) is a chemical compound with the molecular formula C12H21N3O6 and a molecular weight of 303.31 g/mol. IUPAC name: 2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetic acid. InChIKey: RIBHQSRGHUDSSF-ZETCQYMHSA-N.
| Molecular formula | C12H21N3O6 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | 2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetic acid |
| InChIKey | RIBHQSRGHUDSSF-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)NCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)