CAS 115044-52-5 appears in our catalog under these names: 3-Nitroaniline-2,4,5,6-d4, 3-Nitroaniline D4, 3-Nitroaniline-2,4,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, Dr. Ehrenstorfer, CDN. Available pack sizes: 100mg, 10mg, 0,5g, 0,25g.
2,3,4,6-tetradeuterio-5-nitroaniline (CAS 115044-52-5) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 142.15 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-nitroaniline. InChIKey: XJCVRTZCHMZPBD-RHQRLBAQSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-nitroaniline |
| InChIKey | XJCVRTZCHMZPBD-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])[2H])N)[2H] |
Computed by PubChem (NCBI)