Products 115047-89-7
CAS 115047-89-7 appears in our catalog under these names: H-Asn-AMC, H–Asn–AMC, H-Asn-AMC trifluoroacetate salt. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)butanediamide (CAS 115047-89-7) is a chemical compound with the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. IUPAC name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)butanediamide. InChIKey: JGDQPBLEUGZCSJ-JTQLQIEISA-N.
| Molecular formula | C14H15N3O4 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)butanediamide |
| InChIKey | JGDQPBLEUGZCSJ-JTQLQIEISA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC(=O)N)N |
Computed by PubChem (NCBI)