CAS 1150567-72-8 appears in our catalog under these names: 6-CHLOROIMIDAZO(1,2-B)PYRIDAZINE-3-SULFONYL CHLORIDE, 95%, 6-Chloroimidazo(1,2-b)pyridazine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-chloroimidazo[1,2-b]pyridazine-3-sulfonyl chloride (CAS 1150567-72-8) is a chemical compound with the molecular formula C6H3Cl2N3O2S and a molecular weight of 252.08 g/mol. IUPAC name: 6-chloroimidazo[1,2-b]pyridazine-3-sulfonyl chloride. InChIKey: NEOGGLAEQUEMEY-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O2S |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | 6-chloroimidazo[1,2-b]pyridazine-3-sulfonyl chloride |
| InChIKey | NEOGGLAEQUEMEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NC=C2S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)