CAS 1150654-57-1 appears in our catalog under these names: Ethyl phenoxyacetate-4-trifluoroborate potassium salt, 95%, Ethyl phenoxyacetate-4-trifluoroborate potassium salt, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 25g, 1g, 5g.
Potassium [4-(2-ethoxy-2-oxoethoxy)phenyl]-trifluoroboranuide (CAS 1150654-57-1) is a chemical compound with the molecular formula C10H11BF3KO3 and a molecular weight of 286.10 g/mol. IUPAC name: potassium [4-(2-ethoxy-2-oxoethoxy)phenyl]-trifluoroboranuide. InChIKey: DHFZZPHCWFAYGB-UHFFFAOYSA-N.
| Molecular formula | C10H11BF3KO3 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | potassium [4-(2-ethoxy-2-oxoethoxy)phenyl]-trifluoroboranuide |
| InChIKey | DHFZZPHCWFAYGB-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)OCC(=O)OCC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)