CAS 1150654-77-5 is the registry number for 1,3-Dimethyluracil-5-trifluoroborate potassium salt, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Potassium (1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-trifluoroboranuide (CAS 1150654-77-5) is a chemical compound with the molecular formula C6H7BF3KN2O2 and a molecular weight of 246.04 g/mol. IUPAC name: potassium (1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-trifluoroboranuide. InChIKey: ZHOBXMTYGILESR-UHFFFAOYSA-N.
| Molecular formula | C6H7BF3KN2O2 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | potassium (1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-trifluoroboranuide |
| InChIKey | ZHOBXMTYGILESR-UHFFFAOYSA-N |
| SMILES | [B-](C1=CN(C(=O)N(C1=O)C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)