CAS 1150655-10-9 is the registry number for Potassium 2,4-bis(trifluoromethyl)phenyltrifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Potassium [2,4-bis(trifluoromethyl)phenyl]-trifluoroboranuide (CAS 1150655-10-9) is a chemical compound with the molecular formula C8H3BF9K and a molecular weight of 320.01 g/mol. IUPAC name: potassium [2,4-bis(trifluoromethyl)phenyl]-trifluoroboranuide. InChIKey: OXVQSBLFWHNZJA-UHFFFAOYSA-N.
| Molecular formula | C8H3BF9K |
|---|---|
| Molecular weight | 320.01 g/mol |
| IUPAC name | potassium [2,4-bis(trifluoromethyl)phenyl]-trifluoroboranuide |
| InChIKey | OXVQSBLFWHNZJA-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)