Products 115102-33-5

CAS 115102-33-5 is the registry number for 7-Chloro-1,3-naphthalenedisulfonyl Dichloride. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

7-chloronaphthalene-1,3-disulfonyl chloride (CAS 115102-33-5) is a chemical compound with the molecular formula C10H5Cl3O4S2 and a molecular weight of 359.6 g/mol. IUPAC name: 7-chloronaphthalene-1,3-disulfonyl chloride. InChIKey: OOTRHHFTOJGBRG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl3O4S2
Molecular weight359.6 g/mol
IUPAC name7-chloronaphthalene-1,3-disulfonyl chloride
InChIKeyOOTRHHFTOJGBRG-UHFFFAOYSA-N
SMILESC1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)