CAS 115102-33-5 is the registry number for 7-Chloro-1,3-naphthalenedisulfonyl Dichloride. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
7-chloronaphthalene-1,3-disulfonyl chloride (CAS 115102-33-5) is a chemical compound with the molecular formula C10H5Cl3O4S2 and a molecular weight of 359.6 g/mol. IUPAC name: 7-chloronaphthalene-1,3-disulfonyl chloride. InChIKey: OOTRHHFTOJGBRG-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3O4S2 |
|---|---|
| Molecular weight | 359.6 g/mol |
| IUPAC name | 7-chloronaphthalene-1,3-disulfonyl chloride |
| InChIKey | OOTRHHFTOJGBRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)