CAS 115102-84-6 appears in our catalog under these names: Sulfalene Impurity 2, O-desmethyl-Sulfamethoxypyrazine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-amino-N-(2-oxo-1H-pyrazin-3-yl)benzenesulfonamide (CAS 115102-84-6) is a chemical compound with the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. IUPAC name: 4-amino-N-(2-oxo-1H-pyrazin-3-yl)benzenesulfonamide. InChIKey: RMMBZTRAHBBVDE-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O3S |
|---|---|
| Molecular weight | 266.28 g/mol |
| IUPAC name | 4-amino-N-(2-oxo-1H-pyrazin-3-yl)benzenesulfonamide |
| InChIKey | RMMBZTRAHBBVDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=CNC2=O |
Computed by PubChem (NCBI)