CAS 115135-38-1 is the registry number for 3-Hydroxy-3-methylglutaric-d3 Anhydride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-hydroxy-4-(trideuteriomethyl)oxane-2,6-dione (CAS 115135-38-1) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 147.14 g/mol. IUPAC name: 4-hydroxy-4-(trideuteriomethyl)oxane-2,6-dione. InChIKey: UWOCHZAKVUAJQJ-FIBGUPNXSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | 4-hydroxy-4-(trideuteriomethyl)oxane-2,6-dione |
| InChIKey | UWOCHZAKVUAJQJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1(CC(=O)OC(=O)C1)O |
Computed by PubChem (NCBI)