CAS 1151512-26-3 appears in our catalog under these names: (5R,6R)-2,2-Dimethyl-1,3-dioxepane-5,6-diol, (5R,6R)-2,2-Dimethyl-1,3-dioxepane-5,6-diol, 97% . Offered by: TRC, Thermo Scientific. Available pack sizes: 500mg.
(5R,6R)-2,2-dimethyl-1,3-dioxepane-5,6-diol (CAS 1151512-26-3) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: (5R,6R)-2,2-dimethyl-1,3-dioxepane-5,6-diol. InChIKey: ZCYLFZNEKLJZFK-PHDIDXHHSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (5R,6R)-2,2-dimethyl-1,3-dioxepane-5,6-diol |
| InChIKey | ZCYLFZNEKLJZFK-PHDIDXHHSA-N |
| SMILES | CC1(OC[C@H]([C@@H](CO1)O)O)C |
Computed by PubChem (NCBI)