CAS 115152-09-5 is the registry number for 2-Iodoxanthen-9-one. Offered by: TRC. Available pack sizes: 2,5g.
2-iodoxanthen-9-one (CAS 115152-09-5) is a chemical compound with the molecular formula C13H7IO2 and a molecular weight of 322.10 g/mol. IUPAC name: 2-iodoxanthen-9-one. InChIKey: DYZHANZDOXAFNC-UHFFFAOYSA-N.
| Molecular formula | C13H7IO2 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | 2-iodoxanthen-9-one |
| InChIKey | DYZHANZDOXAFNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)I |
Computed by PubChem (NCBI)