CAS 1151802-05-9 is the registry number for 7-Fluoro-1h-[1,5]naphthyridin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
7-fluoro-1H-1,5-naphthyridin-4-one (CAS 1151802-05-9) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 7-fluoro-1H-1,5-naphthyridin-4-one. InChIKey: XPJNOFYNSDLDOF-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 7-fluoro-1H-1,5-naphthyridin-4-one |
| InChIKey | XPJNOFYNSDLDOF-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C1=O)N=CC(=C2)F |
Computed by PubChem (NCBI)