CAS 1151987-49-3 is the registry number for 3-(tert-Butyl-dimethyl-silanyloxy)-4-methyl-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[tert-butyl(dimethyl)silyl]oxy-4-methylaniline (CAS 1151987-49-3) is a chemical compound with the molecular formula C13H23NOSi and a molecular weight of 237.41 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-4-methylaniline. InChIKey: ZDOTXVFFQGRDNI-UHFFFAOYSA-N.
| Molecular formula | C13H23NOSi |
|---|---|
| Molecular weight | 237.41 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-4-methylaniline |
| InChIKey | ZDOTXVFFQGRDNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)