CAS 1152091-69-4 is the registry number for 2-Methyllamotrigine Methanesulfonate. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 50mg.
6-(2,3-dichlorophenyl)-3-imino-2-methyl-1,2,4-triazin-5-amine;methanesulfonic acid (CAS 1152091-69-4) is a chemical compound with the molecular formula C11H13Cl2N5O3S and a molecular weight of 366.2 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-3-imino-2-methyl-1,2,4-triazin-5-amine;methanesulfonic acid. InChIKey: FFIREEFHIDPSTQ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N5O3S |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-3-imino-2-methyl-1,2,4-triazin-5-amine;methanesulfonic acid |
| InChIKey | FFIREEFHIDPSTQ-UHFFFAOYSA-N |
| SMILES | CN1C(=N)N=C(C(=N1)C2=C(C(=CC=C2)Cl)Cl)N.CS(=O)(=O)O |
Computed by PubChem (NCBI)