CAS 1152131-73-1 appears in our catalog under these names: Lapatinib Impurity 10, Lapatinib Impurity 21, Lapatinib Impurity 6, 5-(4-((3-Chloro-4-((3-fluorobenzyl)oxy)phenyl)amino)quinazolin-6-yl)furan-2-carboxylic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-carboxylic acid (CAS 1152131-73-1) is a chemical compound with the molecular formula C26H17ClFN3O4 and a molecular weight of 489.9 g/mol. IUPAC name: 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-carboxylic acid. InChIKey: ALLDUFLYKPDTCS-UHFFFAOYSA-N.
| Molecular formula | C26H17ClFN3O4 |
|---|---|
| Molecular weight | 489.9 g/mol |
| IUPAC name | 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-carboxylic acid |
| InChIKey | ALLDUFLYKPDTCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)COC2=C(C=C(C=C2)NC3=NC=NC4=C3C=C(C=C4)C5=CC=C(O5)C(=O)O)Cl |
Computed by PubChem (NCBI)