CAS 115220-11-6 appears in our catalog under these names: Tianeptine Impurity 15, Tianeptine Metabolite MC5 Sodium Salt, >95% (HPLC), Tianeptine Metabolite MC5 sodium, Tianeptine metabolite MC5 (sodium salt), Tianeptine MC5-d4 (pentanoic acid metabolite). Offered by: Hubei YoungXin, TRC, TargetMol, MedChemExpress, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 5 mg.
Sodium 5-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]pentanoate (CAS 115220-11-6) is a chemical compound with the molecular formula C19H20ClN2NaO4S and a molecular weight of 430.9 g/mol. IUPAC name: sodium 5-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]pentanoate. InChIKey: GBYSEZGRQUELJJ-UHFFFAOYSA-M.
| Molecular formula | C19H20ClN2NaO4S |
|---|---|
| Molecular weight | 430.9 g/mol |
| IUPAC name | sodium 5-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]pentanoate |
| InChIKey | GBYSEZGRQUELJJ-UHFFFAOYSA-M |
| SMILES | CN1C2=CC=CC=C2C(C3=C(S1(=O)=O)C=C(C=C3)Cl)NCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)