CAS 1152439-74-1 is the registry number for Sitagliptin Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate (CAS 1152439-74-1) is a chemical compound with the molecular formula C17H22F3NO4 and a molecular weight of 361.4 g/mol. IUPAC name: ethyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate. InChIKey: DRSJQTJVYUFHPJ-LLVKDONJSA-N.
| Molecular formula | C17H22F3NO4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | ethyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate |
| InChIKey | DRSJQTJVYUFHPJ-LLVKDONJSA-N |
| SMILES | CCOC(=O)C[C@@H](CC1=CC(=C(C=C1F)F)F)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)