CAS 115249-95-1 is the registry number for 2′,3′-Dideoxy-3′-fluoro-5-methylcytidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one (CAS 115249-95-1) is a chemical compound with the molecular formula C10H14FN3O3 and a molecular weight of 243.23 g/mol. IUPAC name: 4-amino-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one. InChIKey: YTMNCNXZZRCBFC-XLPZGREQSA-N.
| Molecular formula | C10H14FN3O3 |
|---|---|
| Molecular weight | 243.23 g/mol |
| IUPAC name | 4-amino-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| InChIKey | YTMNCNXZZRCBFC-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)N=C1N)[C@H]2C[C@@H]([C@H](O2)CO)F |
Computed by PubChem (NCBI)