CAS 1152540-21-0 appears in our catalog under these names: 3-(3-Chloro-4-fluorophenyl)-1H-pyrazole-4-carboxylic acid, 95%, 3-(3-Chloro-4-fluorophenyl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(3-chloro-4-fluorophenyl)-1H-pyrazole-4-carboxylic acid (CAS 1152540-21-0) is a chemical compound with the molecular formula C10H6ClFN2O2 and a molecular weight of 240.62 g/mol. IUPAC name: 5-(3-chloro-4-fluorophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: LRWMSVCCLRUPDR-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2O2 |
|---|---|
| Molecular weight | 240.62 g/mol |
| IUPAC name | 5-(3-chloro-4-fluorophenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | LRWMSVCCLRUPDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=NN2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)