CAS 1152542-00-1 appears in our catalog under these names: 5-((2-Chloro-6-fluorophenyl)methyl)-1,3,4-oxadiazole-2-thiol, 95%, 5-((2-Chloro-6-fluorophenyl)methyl)-1,3,4-oxadiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-[(2-chloro-6-fluorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 1152542-00-1) is a chemical compound with the molecular formula C9H6ClFN2OS and a molecular weight of 244.67 g/mol. IUPAC name: 5-[(2-chloro-6-fluorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: RHITZEQDAPOBMB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2OS |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 5-[(2-chloro-6-fluorophenyl)methyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | RHITZEQDAPOBMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC2=NNC(=S)O2)F |
Computed by PubChem (NCBI)