Products 1152548-23-6
CAS 1152548-23-6 is the registry number for 1-tert-Butyl-3-(2,4-difluorophenyl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-tert-butyl-3-(2,4-difluorophenyl)pyrazole-4-carboxylic acid (CAS 1152548-23-6) is a chemical compound with the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. IUPAC name: 1-tert-butyl-3-(2,4-difluorophenyl)pyrazole-4-carboxylic acid. InChIKey: JTNKVPOLGOGWKN-UHFFFAOYSA-N.
| Molecular formula | C14H14F2N2O2 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | 1-tert-butyl-3-(2,4-difluorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | JTNKVPOLGOGWKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(C(=N1)C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)