CAS 115256-45-6 appears in our catalog under these names: Dofetilide Impurity 12, N-Desaminomethylsulfonyl-N-nitryl Dofetilide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-[2-[methyl-[2-(4-nitrophenoxy)ethyl]amino]ethyl]phenyl]methanesulfonamide (CAS 115256-45-6) is a chemical compound with the molecular formula C18H23N3O5S and a molecular weight of 393.5 g/mol. IUPAC name: N-[4-[2-[methyl-[2-(4-nitrophenoxy)ethyl]amino]ethyl]phenyl]methanesulfonamide. InChIKey: HUSUTKNOYKBODA-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | N-[4-[2-[methyl-[2-(4-nitrophenoxy)ethyl]amino]ethyl]phenyl]methanesulfonamide |
| InChIKey | HUSUTKNOYKBODA-UHFFFAOYSA-N |
| SMILES | CN(CCC1=CC=C(C=C1)NS(=O)(=O)C)CCOC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)