CAS 1152568-45-0 appears in our catalog under these names: (1-[3-(Trifluoromethyl)phenyl]cyclopentyl)methanamine, 95%, {1-(3-(Trifluoromethyl)phenyl)cyclopentyl}methanamine, (1-(3-(Trifluoromethyl)phenyl)cyclopentyl)methanamine 95%, (1-[3-(Trifluoromethyl)phenyl]cyclopentyl)methanamine, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g.
[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanamine (CAS 1152568-45-0) is a chemical compound with the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. IUPAC name: [1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanamine. InChIKey: VZMRAPSRBGTZOB-UHFFFAOYSA-N.
| Molecular formula | C13H16F3N |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | [1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanamine |
| InChIKey | VZMRAPSRBGTZOB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CN)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)