CAS 1152598-13-4 is the registry number for 4-Amino-5-(4-chloro-2-fluorophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-(4-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione (CAS 1152598-13-4) is a chemical compound with the molecular formula C8H6ClFN4S and a molecular weight of 244.68 g/mol. IUPAC name: 4-amino-3-(4-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: BWDZCQBJBQSNTE-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN4S |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | 4-amino-3-(4-chloro-2-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | BWDZCQBJBQSNTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C2=NNC(=S)N2N |
Computed by PubChem (NCBI)