CAS 1152603-53-6 appears in our catalog under these names: 2,2-Dimethyl-N-(2-(5-sulfamoylthiophen-2-yl)ethyl)propanamide, 95%, 2,2-Dimethyl-N-(2-(5-sulfamoylthiophen-2-yl)ethyl)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,2-dimethyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]propanamide (CAS 1152603-53-6) is a chemical compound with the molecular formula C11H18N2O3S2 and a molecular weight of 290.4 g/mol. IUPAC name: 2,2-dimethyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]propanamide. InChIKey: BKPLADZUDINSCL-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2,2-dimethyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]propanamide |
| InChIKey | BKPLADZUDINSCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCCC1=CC=C(S1)S(=O)(=O)N |
Computed by PubChem (NCBI)