Products 1152652-73-7
CAS 1152652-73-7 is the registry number for 3-(2,2-Dimethylpropyl)-1-phenyl-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(2,2-dimethylpropyl)-1-phenylpyrazol-5-amine (CAS 1152652-73-7) is a chemical compound with the molecular formula C14H19N3 and a molecular weight of 229.32 g/mol. IUPAC name: 3-(2,2-dimethylpropyl)-1-phenylpyrazol-5-amine. InChIKey: LUSMIAQSCDSBNN-UHFFFAOYSA-N.
| Molecular formula | C14H19N3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | 3-(2,2-dimethylpropyl)-1-phenylpyrazol-5-amine |
| InChIKey | LUSMIAQSCDSBNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC1=NN(C(=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)