CAS 1152711-96-0 appears in our catalog under these names: 3-Cyclohexyl-1-phenyl-1h-pyrazol-5-amine, 95%, 3-Cyclohexyl-1-phenyl-1H-pyrazol-5-amine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10mg, 25mg.
3-cyclohexyl-1-phenylpyrazol-5-amine (CAS 1152711-96-0) is a chemical compound with the molecular formula C15H19N3 and a molecular weight of 241.33 g/mol. IUPAC name: 3-cyclohexyl-1-phenylpyrazol-5-amine. InChIKey: QYGBFVMPZTXNSQ-UHFFFAOYSA-N.
| Molecular formula | C15H19N3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | 3-cyclohexyl-1-phenylpyrazol-5-amine |
| InChIKey | QYGBFVMPZTXNSQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NN(C(=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)