CAS 1152782-19-8 appears in our catalog under these names: A 1120, 95%, A 1120/ 99.47% (existing batch purity), A 1120, A 1120, A 1120 99+%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
2-[[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]amino]benzoic acid (CAS 1152782-19-8) is a chemical compound with the molecular formula C20H19F3N2O3 and a molecular weight of 392.4 g/mol. IUPAC name: 2-[[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]amino]benzoic acid. InChIKey: MEAQCLPMSVEOQF-UHFFFAOYSA-N.
| Molecular formula | C20H19F3N2O3 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 2-[[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]amino]benzoic acid |
| InChIKey | MEAQCLPMSVEOQF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=CC=CC=C2C(F)(F)F)C(=O)NC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)