Products 1152995-99-7
CAS 1152995-99-7 appears in our catalog under these names: (1–(3，5–dimethylphenyl)cyclopropyl)methanamine hydrochloride, [1-(3,5-dimethylphenyl)cyclopropyl]methanamine. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
[1-(3,5-dimethylphenyl)cyclopropyl]methanamine (CAS 1152995-99-7) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: [1-(3,5-dimethylphenyl)cyclopropyl]methanamine. InChIKey: LSTXHBKESLODFM-UHFFFAOYSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | [1-(3,5-dimethylphenyl)cyclopropyl]methanamine |
| InChIKey | LSTXHBKESLODFM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2(CC2)CN)C |
Computed by PubChem (NCBI)