Products 1152996-20-7
CAS 1152996-20-7 appears in our catalog under these names: 1–(3，5–dimethylphenyl)cyclobutan–1–amine hydrochloride, 1-(3,5-dimethylphenyl)cyclobutan-1-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
1-(3,5-dimethylphenyl)cyclobutan-1-amine (CAS 1152996-20-7) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)cyclobutan-1-amine. InChIKey: PIZKLIGVTRVTMD-UHFFFAOYSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)cyclobutan-1-amine |
| InChIKey | PIZKLIGVTRVTMD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2(CCC2)N)C |
Computed by PubChem (NCBI)