Products 1153025-98-9
CAS 1153025-98-9 is the registry number for 5-Bromo-N-methyl-N-(2-(methylamino)-2-oxoethyl)thiophene-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]thiophene-3-carboxamide (CAS 1153025-98-9) is a chemical compound with the molecular formula C9H11BrN2O2S and a molecular weight of 291.17 g/mol. IUPAC name: 5-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]thiophene-3-carboxamide. InChIKey: JAYKITULIWEKTG-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2S |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | 5-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]thiophene-3-carboxamide |
| InChIKey | JAYKITULIWEKTG-UHFFFAOYSA-N |
| SMILES | CNC(=O)CN(C)C(=O)C1=CSC(=C1)Br |
Computed by PubChem (NCBI)